C17H15ClN2O5 — CID 3874172
2-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoic acid (PubChem CID 3874172) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3874172 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoic acid |
| SMILES | O=C(CC(Cc1ccc(Cl)cc1)C(=O)O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClN2O5/c18-13-3-1-11(2-4-13)9-12(17(22)23)10-16(21)19-14-5-7-15(8-6-14)20(24)25/h1-8,12H,9-10H2,(H,19,21)(H,22,23) |
| InChIKey | YKHSFKYHHLUMCK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|