C16H13Cl2N3O5 — CID 154805254
3-(3,5-dichlorophenyl)-2-[(4-nitrophenyl)carbamoylamino]propanoic acid (PubChem CID 154805254) has the molecular formula C16H13Cl2N3O5 and a molecular weight of 398.20 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-[(4-nitrophenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-2-[(4-nitrophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 154805254 |
| Molecular Formula | C16H13Cl2N3O5 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-[(4-nitrophenyl)carbamoylamino]propanoic acid |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)NC(Cc1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H13Cl2N3O5/c17-10-5-9(6-11(18)8-10)7-14(15(22)23)20-16(24)19-12-1-3-13(4-2-12)21(25)26/h1-6,8,14H,7H2,(H,22,23)(H2,19,20,24) |
| InChIKey | UEVKAFQZWRLCIX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|