C18H17N5O5 — CID 87927906
N-(cyanomethyl)-3-(4-hydroxyphenyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide (PubChem CID 87927906) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(4-hydroxyphenyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide.
| Compound Name | N-(cyanomethyl)-3-(4-hydroxyphenyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 87927906 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(cyanomethyl)-3-(4-hydroxyphenyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide |
| SMILES | N#CCNC(=O)C(Cc1ccc(O)cc1)NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N5O5/c19-9-10-20-17(25)16(11-12-1-7-15(24)8-2-12)22-18(26)21-13-3-5-14(6-4-13)23(27)28/h1-8,16,24H,10-11H2,(H,20,25)(H2,21,22,26) |
| InChIKey | ZLOGONKDBNJQFN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 157.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|