C13H15N5O3S2 — CID 10473281
N-(cyanomethyl)-3-methylsulfanyl-2-[(4-nitrophenyl)carbamothioylamino]propanamide (PubChem CID 10473281) has the molecular formula C13H15N5O3S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-(cyanomethyl)-3-methylsulfanyl-2-[(4-nitrophenyl)carbamothioylamino]propanamide.
| Compound Name | N-(cyanomethyl)-3-methylsulfanyl-2-[(4-nitrophenyl)carbamothioylamino]propanamide |
|---|---|
| PubChem CID | 10473281 |
| Molecular Formula | C13H15N5O3S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(cyanomethyl)-3-methylsulfanyl-2-[(4-nitrophenyl)carbamothioylamino]propanamide |
| SMILES | CSCC(NC(=S)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC#N |
| InChI | InChI=1S/C13H15N5O3S2/c1-23-8-11(12(19)15-7-6-14)17-13(22)16-9-2-4-10(5-3-9)18(20)21/h2-5,11H,7-8H2,1H3,(H,15,19)(H2,16,17,22) |
| InChIKey | KBYGGHRXYDOXGQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|