C18H18N4OS — CID 11724702
N-(cyanomethyl)-3-phenyl-2-(phenylcarbamothioylamino)propanamide (PubChem CID 11724702) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-(cyanomethyl)-3-phenyl-2-(phenylcarbamothioylamino)propanamide.
| Compound Name | N-(cyanomethyl)-3-phenyl-2-(phenylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 11724702 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(cyanomethyl)-3-phenyl-2-(phenylcarbamothioylamino)propanamide |
| SMILES | N#CCNC(=O)C(Cc1ccccc1)NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H18N4OS/c19-11-12-20-17(23)16(13-14-7-3-1-4-8-14)22-18(24)21-15-9-5-2-6-10-15/h1-10,16H,12-13H2,(H,20,23)(H2,21,22,24) |
| InChIKey | GQLFTMNMFOIWAG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|