C19H20N4O2 — CID 87927353
2-(benzylcarbamoylamino)-N-(cyanomethyl)-3-phenylpropanamide (PubChem CID 87927353) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-(cyanomethyl)-3-phenylpropanamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-(cyanomethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 87927353 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-(cyanomethyl)-3-phenylpropanamide |
| SMILES | N#CCNC(=O)C(Cc1ccccc1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H20N4O2/c20-11-12-21-18(24)17(13-15-7-3-1-4-8-15)23-19(25)22-14-16-9-5-2-6-10-16/h1-10,17H,12-14H2,(H,21,24)(H2,22,23,25) |
| InChIKey | OTVSXBGPIUFEMH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|