C20H17N5O4S — CID 87926948
3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide (PubChem CID 87926948) has the molecular formula C20H17N5O4S and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide.
| Compound Name | 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 87926948 |
| Molecular Formula | C20H17N5O4S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(4-nitrophenyl)carbamoylamino]propanamide |
| SMILES | N#CCNC(=O)C(Cc1csc2ccccc12)NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N5O4S/c21-9-10-22-19(26)17(11-13-12-30-18-4-2-1-3-16(13)18)24-20(27)23-14-5-7-15(8-6-14)25(28)29/h1-8,12,17H,10-11H2,(H,22,26)(H2,23,24,27) |
| InChIKey | GAIWOBTXSBGNEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|