C21H18N4O4S — CID 23018427
N-[3-(1-benzothiophen-3-yl)-1-(2-cyanoethylamino)-1-oxopropan-2-yl]-2-nitrobenzamide (PubChem CID 23018427) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-[3-(1-benzothiophen-3-yl)-1-(2-cyanoethylamino)-1-oxopropan-2-yl]-2-nitrobenzamide.
| Compound Name | N-[3-(1-benzothiophen-3-yl)-1-(2-cyanoethylamino)-1-oxopropan-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 23018427 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[3-(1-benzothiophen-3-yl)-1-(2-cyanoethylamino)-1-oxopropan-2-yl]-2-nitrobenzamide |
| SMILES | N#CCCNC(=O)C(Cc1csc2ccccc12)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18N4O4S/c22-10-5-11-23-21(27)17(12-14-13-30-19-9-4-2-6-15(14)19)24-20(26)16-7-1-3-8-18(16)25(28)29/h1-4,6-9,13,17H,5,11-12H2,(H,23,27)(H,24,26) |
| InChIKey | VPLUGFKOYFXRKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|