C22H22N4O2S — CID 87927479
3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(2,6-dimethylphenyl)carbamoylamino]propanamide (PubChem CID 87927479) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(2,6-dimethylphenyl)carbamoylamino]propanamide.
| Compound Name | 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(2,6-dimethylphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 87927479 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-N-(cyanomethyl)-2-[(2,6-dimethylphenyl)carbamoylamino]propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)NC(Cc1csc2ccccc12)C(=O)NCC#N |
| InChI | InChI=1S/C22H22N4O2S/c1-14-6-5-7-15(2)20(14)26-22(28)25-18(21(27)24-11-10-23)12-16-13-29-19-9-4-3-8-17(16)19/h3-9,13,18H,11-12H2,1-2H3,(H,24,27)(H2,25,26,28) |
| InChIKey | AEDUYGIINXMBHL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|