C26H23N5O3 — CID 10072609
N-(cyanomethyl)-3-(1H-indol-3-yl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide (PubChem CID 10072609) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(1H-indol-3-yl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide.
| Compound Name | N-(cyanomethyl)-3-(1H-indol-3-yl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 10072609 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-(cyanomethyl)-3-(1H-indol-3-yl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide |
| SMILES | N#CCNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O3/c27-14-15-28-25(32)24(16-18-17-29-23-9-5-4-8-22(18)23)31-26(33)30-19-10-12-21(13-11-19)34-20-6-2-1-3-7-20/h1-13,17,24,29H,15-16H2,(H,28,32)(H2,30,31,33) |
| InChIKey | JIQVMYBUZAGONL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|