C22H23N5O2S — CID 87927834
N-(2-cyanoethyl)-3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamothioylamino]propanamide (PubChem CID 87927834) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamothioylamino]propanamide.
| Compound Name | N-(2-cyanoethyl)-3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamothioylamino]propanamide |
|---|---|
| PubChem CID | 87927834 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(2-cyanoethyl)-3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamothioylamino]propanamide |
| SMILES | COc1ccc(NC(=S)NC(Cc2c[nH]c3ccccc23)C(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-29-17-9-7-16(8-10-17)26-22(30)27-20(21(28)24-12-4-11-23)13-15-14-25-19-6-3-2-5-18(15)19/h2-3,5-10,14,20,25H,4,12-13H2,1H3,(H,24,28)(H2,26,27,30) |
| InChIKey | YBXXWDAPGBLFBT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|