C20H19N3O4S — CID 139069173
(2S)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)carbamothioylamino]propanoic acid (PubChem CID 139069173) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)carbamothioylamino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 139069173 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)carbamothioylamino]propanoic acid |
| SMILES | COc1ccc(C(=O)NC(=S)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C20H19N3O4S/c1-27-14-8-6-12(7-9-14)18(24)23-20(28)22-17(19(25)26)10-13-11-21-16-5-3-2-4-15(13)16/h2-9,11,17,21H,10H2,1H3,(H,25,26)(H2,22,23,24,28)/t17-/m0/s1 |
| InChIKey | LUKDNACVDPSQDZ-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|