C18H18N2O5S — CID 5144045
3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 5144045) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 5144045 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2c[nH]c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-25-13-6-8-14(9-7-13)26(23,24)20-17(18(21)22)10-12-11-19-16-5-3-2-4-15(12)16/h2-9,11,17,19-20H,10H2,1H3,(H,21,22) |
| InChIKey | VBZKTKSXUUPPES-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |