C26H27N5O5S — CID 155168534
1-[[(2S)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]-3-(4-methoxyphenyl)urea (PubChem CID 155168534) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is 1-[[(2S)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[(2S)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 155168534 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 1-[[(2S)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NNC(=O)[C@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27N5O5S/c1-17-7-13-21(14-8-17)37(34,35)31-24(15-18-16-27-23-6-4-3-5-22(18)23)25(32)29-30-26(33)28-19-9-11-20(36-2)12-10-19/h3-14,16,24,27,31H,15H2,1-2H3,(H,29,32)(H2,28,30,33)/t24-/m0/s1 |
| InChIKey | KUSZKBOAJPXHTG-DEOSSOPVSA-N |
| XLogP | 3.23 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|