C23H28ClN3O3S — CID 155169179
N-(4-chloropentyl)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 155169179) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is N-(4-chloropentyl)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(4-chloropentyl)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 155169179 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-(4-chloropentyl)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NCCCC(C)Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-16-9-11-19(12-10-16)31(29,30)27-22(23(28)25-13-5-6-17(2)24)14-18-15-26-21-8-4-3-7-20(18)21/h3-4,7-12,15,17,22,26-27H,5-6,13-14H2,1-2H3,(H,25,28) |
| InChIKey | BELXAVSGLCQWGZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|