C23H20IN3O4S — CID 11467131
N-hydroxy-3-(1H-indol-3-yl)-2-[[4-(4-iodophenyl)phenyl]sulfonylamino]propanamide (PubChem CID 11467131) has the molecular formula C23H20IN3O4S and a molecular weight of 561.40 g/mol. Its IUPAC name is N-hydroxy-3-(1H-indol-3-yl)-2-[[4-(4-iodophenyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-hydroxy-3-(1H-indol-3-yl)-2-[[4-(4-iodophenyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 11467131 |
| Molecular Formula | C23H20IN3O4S |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | N-hydroxy-3-(1H-indol-3-yl)-2-[[4-(4-iodophenyl)phenyl]sulfonylamino]propanamide |
| SMILES | O=C(NO)C(Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(-c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C23H20IN3O4S/c24-18-9-5-15(6-10-18)16-7-11-19(12-8-16)32(30,31)27-22(23(28)26-29)13-17-14-25-21-4-2-1-3-20(17)21/h1-12,14,22,25,27,29H,13H2,(H,26,28) |
| InChIKey | BXVZTKHGECRXMY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|