C28H26N4O5 — CID 155547991
4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[3-(1H-indol-3-yl)-1-(4-methoxyanilino)-1-oxopropan-2-yl]benzamide (PubChem CID 155547991) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[3-(1H-indol-3-yl)-1-(4-methoxyanilino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[3-(1H-indol-3-yl)-1-(4-methoxyanilino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 155547991 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[3-(1H-indol-3-yl)-1-(4-methoxyanilino)-1-oxopropan-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)c2ccc(/C=C/C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C28H26N4O5/c1-37-22-13-11-21(12-14-22)30-28(35)25(16-20-17-29-24-5-3-2-4-23(20)24)31-27(34)19-9-6-18(7-10-19)8-15-26(33)32-36/h2-15,17,25,29,36H,16H2,1H3,(H,30,35)(H,31,34)(H,32,33)/b15-8+ |
| InChIKey | VQYSYIFCBDEVND-OVCLIPMQSA-N |
| XLogP | 3.67 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|