C21H19FN2O3 — CID 78512327
methyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 78512327) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is methyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 78512327 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O3/c1-27-21(26)19(12-15-13-23-18-5-3-2-4-17(15)18)24-20(25)11-8-14-6-9-16(22)10-7-14/h2-11,13,19,23H,12H2,1H3,(H,24,25) |
| InChIKey | OCWNAMNTMSVTQR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|