C19H24N2O3 — CID 6161985
methyl 3-(1H-indol-3-yl)-2-[[(E)-5-methylhex-2-enoyl]amino]propanoate (PubChem CID 6161985) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 3-(1H-indol-3-yl)-2-[[(E)-5-methylhex-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(1H-indol-3-yl)-2-[[(E)-5-methylhex-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 6161985 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl 3-(1H-indol-3-yl)-2-[[(E)-5-methylhex-2-enoyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)/C=C/CC(C)C |
| InChI | InChI=1S/C19H24N2O3/c1-13(2)7-6-10-18(22)21-17(19(23)24-3)11-14-12-20-16-9-5-4-8-15(14)16/h4-6,8-10,12-13,17,20H,7,11H2,1-3H3,(H,21,22)/b10-6+ |
| InChIKey | KRZDBXJGXMHTMF-UXBLZVDNSA-N |
| XLogP | 2.97 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|