C22H22N2O3 — CID 55939860
methyl (2R)-3-(1H-indol-3-yl)-2-(3-phenylbut-2-enoylamino)propanoate (PubChem CID 55939860) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-(3-phenylbut-2-enoylamino)propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-(3-phenylbut-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 55939860 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-(3-phenylbut-2-enoylamino)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)C=C(C)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O3/c1-15(16-8-4-3-5-9-16)12-21(25)24-20(22(26)27-2)13-17-14-23-19-11-7-6-10-18(17)19/h3-12,14,20,23H,13H2,1-2H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | CKJCNPAOSQFHCI-HXUWFJFHSA-N |
| XLogP | 3.47 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|