C22H21FN2O4 — CID 2562425
methyl (2R)-2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 2562425) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 2562425 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl (2R)-2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O4/c1-29-22(28)19(12-15-13-24-18-5-3-2-4-17(15)18)25-21(27)11-10-20(26)14-6-8-16(23)9-7-14/h2-9,13,19,24H,10-12H2,1H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | FIXVGKZDXVOUHY-LJQANCHMSA-N |
| XLogP | 3.17 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |