C22H26FN3O3S — CID 162518776
(4-fluorophenyl)methanamine;methyl (2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoate (PubChem CID 162518776) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is (4-fluorophenyl)methanamine;methyl (2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoate.
| Compound Name | (4-fluorophenyl)methanamine;methyl (2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 162518776 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (4-fluorophenyl)methanamine;methyl (2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCS.NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H18N2O3S.C7H8FN/c1-20-15(19)13(17-14(18)6-7-21)8-10-9-16-12-5-3-2-4-11(10)12;8-7-3-1-6(5-9)2-4-7/h2-5,9,13,16,21H,6-8H2,1H3,(H,17,18);1-4H,5,9H2/t13-;/m0./s1 |
| InChIKey | XBFIRRDRZFEXPK-ZOWNYOTGSA-N |
| XLogP | 2.97 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|