C21H23N3O4S — CID 162518738
benzamide;(2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoic acid (PubChem CID 162518738) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is benzamide;(2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoic acid.
| Compound Name | benzamide;(2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 162518738 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | benzamide;(2S)-3-(1H-indol-3-yl)-2-(3-sulfanylpropanoylamino)propanoic acid |
| SMILES | NC(=O)c1ccccc1.O=C(CCS)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H16N2O3S.C7H7NO/c17-13(5-6-20)16-12(14(18)19)7-9-8-15-11-4-2-1-3-10(9)11;8-7(9)6-4-2-1-3-5-6/h1-4,8,12,15,20H,5-7H2,(H,16,17)(H,18,19);1-5H,(H2,8,9)/t12-;/m0./s1 |
| InChIKey | FBPSEQZDWMUYOW-YDALLXLXSA-N |
| XLogP | 2.39 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|