C20H20N4O3 — CID 59055370
(2S)-2-amino-N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 59055370) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-2-amino-N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 59055370 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2S)-2-amino-N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C20H20N4O3/c21-17(11-14-12-22-18-4-2-1-3-16(14)18)20(26)23-15-8-5-13(6-9-15)7-10-19(25)24-27/h1-10,12,17,22,27H,11,21H2,(H,23,26)(H,24,25)/b10-7+/t17-/m0/s1 |
| InChIKey | DGAGPBOYPGXFNP-JEJOPICUSA-N |
| XLogP | 2.19 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|