C19H20N4O3S — CID 112832302
1-[2-(1-benzothiophen-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea (PubChem CID 112832302) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea.
| Compound Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea |
|---|---|
| PubChem CID | 112832302 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])NCCc1csc2ccccc12 |
| InChI | InChI=1S/C19H20N4O3S/c24-19(21-10-9-14-13-27-18-8-4-1-5-15(14)18)22-12-11-20-16-6-2-3-7-17(16)23(25)26/h1-8,13,20H,9-12H2,(H2,21,22,24) |
| InChIKey | GRLGNTIZHZNGGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|