C16H15BrN2OS2 — CID 112837876
1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]urea (PubChem CID 112837876) has the molecular formula C16H15BrN2OS2 and a molecular weight of 395.35 g/mol. Its IUPAC name is 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]urea.
| Compound Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 112837876 |
| Molecular Formula | C16H15BrN2OS2 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]urea |
| SMILES | O=C(NCCc1csc2ccccc12)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C16H15BrN2OS2/c17-15-6-5-12(22-15)9-19-16(20)18-8-7-11-10-21-14-4-2-1-3-13(11)14/h1-6,10H,7-9H2,(H2,18,19,20) |
| InChIKey | XDHADKDOXIHCNQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |