C20H20BrN3O2S — CID 112831829
2-[2-(1-benzothiophen-3-yl)ethylcarbamoylamino]-N-(4-bromo-2-methylphenyl)acetamide (PubChem CID 112831829) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[2-(1-benzothiophen-3-yl)ethylcarbamoylamino]-N-(4-bromo-2-methylphenyl)acetamide.
| Compound Name | 2-[2-(1-benzothiophen-3-yl)ethylcarbamoylamino]-N-(4-bromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 112831829 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-[2-(1-benzothiophen-3-yl)ethylcarbamoylamino]-N-(4-bromo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)NCCc1csc2ccccc12 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-13-10-15(21)6-7-17(13)24-19(25)11-23-20(26)22-9-8-14-12-27-18-5-3-2-4-16(14)18/h2-7,10,12H,8-9,11H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | GVCYQRMRLJBDIV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |