C17H17BrN2O4S — CID 16540249
[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate (PubChem CID 16540249) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate.
| Compound Name | [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 16540249 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)COC(=O)Cc1cccs1 |
| InChI | InChI=1S/C17H17BrN2O4S/c1-11-7-12(18)4-5-14(11)20-15(21)9-19-16(22)10-24-17(23)8-13-3-2-6-25-13/h2-7H,8-10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | STZXAKKPVKNAAN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |