C16H16BrNO3S — CID 7798730
[2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate (PubChem CID 7798730) has the molecular formula C16H16BrNO3S and a molecular weight of 382.28 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate.
| Compound Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 7798730 |
| Molecular Formula | C16H16BrNO3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-thiophen-2-ylacetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrNO3S/c1-11(12-4-6-13(17)7-5-12)18-15(19)10-21-16(20)9-14-3-2-8-22-14/h2-8,11H,9-10H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | LQIPIGLKNDFRRO-LLVKDONJSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |