C21H20N4OS — CID 87007320
1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 87007320) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 87007320 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCCc1csc2ccccc12)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H20N4OS/c26-21(22-12-10-17-15-27-20-5-2-1-4-19(17)20)23-14-16-6-8-18(9-7-16)25-13-3-11-24-25/h1-9,11,13,15H,10,12,14H2,(H2,22,23,26) |
| InChIKey | QFKYIEFJLJUTPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |