C21H25N5O — CID 55769843
1-[3-(N-methylanilino)propyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 55769843) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[3-(N-methylanilino)propyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 55769843 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | CN(CCCNC(=O)NCc1ccc(-n2cccn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c1-25(19-7-3-2-4-8-19)15-5-13-22-21(27)23-17-18-9-11-20(12-10-18)26-16-6-14-24-26/h2-4,6-12,14,16H,5,13,15,17H2,1H3,(H2,22,23,27) |
| InChIKey | SGKYQOBQYJGJSS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|