C19H22N4OS — CID 55575061
1-(1,3-benzothiazol-2-ylmethyl)-3-[3-(N-methylanilino)propyl]urea (PubChem CID 55575061) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-[3-(N-methylanilino)propyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[3-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 55575061 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[3-(N-methylanilino)propyl]urea |
| SMILES | CN(CCCNC(=O)NCc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C19H22N4OS/c1-23(15-8-3-2-4-9-15)13-7-12-20-19(24)21-14-18-22-16-10-5-6-11-17(16)25-18/h2-6,8-11H,7,12-14H2,1H3,(H2,20,21,24) |
| InChIKey | ARYJEGKZYXYQMV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|