C22H27N3OS — CID 41278298
4-(1,3-benzothiazol-2-yl)-N-[3-(N-ethylanilino)propyl]butanamide (PubChem CID 41278298) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[3-(N-ethylanilino)propyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[3-(N-ethylanilino)propyl]butanamide |
|---|---|
| PubChem CID | 41278298 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[3-(N-ethylanilino)propyl]butanamide |
| SMILES | CCN(CCCNC(=O)CCCc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-25(18-10-4-3-5-11-18)17-9-16-23-21(26)14-8-15-22-24-19-12-6-7-13-20(19)27-22/h3-7,10-13H,2,8-9,14-17H2,1H3,(H,23,26) |
| InChIKey | NMHZNNLWBKRKKS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|