C16H20N2O3S — CID 119190925
3-[4-(1,3-benzothiazol-2-yl)butanoyl-ethylamino]propanoic acid (PubChem CID 119190925) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)butanoyl-ethylamino]propanoic acid.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)butanoyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 119190925 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)butanoyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-18(11-10-16(20)21)15(19)9-5-8-14-17-12-6-3-4-7-13(12)22-14/h3-4,6-7H,2,5,8-11H2,1H3,(H,20,21) |
| InChIKey | UGJGKZKZKWWHME-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |