C17H24N2OS — CID 78783707
4-(1,3-benzothiazol-2-yl)-N-butyl-N-ethylbutanamide (PubChem CID 78783707) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-butyl-N-ethylbutanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-butyl-N-ethylbutanamide |
|---|---|
| PubChem CID | 78783707 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-butyl-N-ethylbutanamide |
| SMILES | CCCCN(CC)C(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-5-13-19(4-2)17(20)12-8-11-16-18-14-9-6-7-10-15(14)21-16/h6-7,9-10H,3-5,8,11-13H2,1-2H3 |
| InChIKey | VJXQTTWOBYFWRG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |