C19H20N2OS2 — CID 78801574
4-(1,3-benzothiazol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 78801574) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 78801574 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H20N2OS2/c1-2-12-21(14-15-7-6-13-23-15)19(22)11-5-10-18-20-16-8-3-4-9-17(16)24-18/h2-4,6-9,13H,1,5,10-12,14H2 |
| InChIKey | CIVNPWMYHNMSIR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|