C15H16N2S2 — CID 83961875
3-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 83961875) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 83961875 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | c1csc(CNCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H16N2S2/c1-2-7-14-13(6-1)17-15(19-14)8-3-9-16-11-12-5-4-10-18-12/h1-2,4-7,10,16H,3,8-9,11H2 |
| InChIKey | OZBOSJYJGZRAGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|