C17H19N3S — CID 83961889
2-[[3-(1,3-benzothiazol-2-yl)propylamino]methyl]aniline (PubChem CID 83961889) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-yl)propylamino]methyl]aniline.
| Compound Name | 2-[[3-(1,3-benzothiazol-2-yl)propylamino]methyl]aniline |
|---|---|
| PubChem CID | 83961889 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-yl)propylamino]methyl]aniline |
| SMILES | Nc1ccccc1CNCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H19N3S/c18-14-7-2-1-6-13(14)12-19-11-5-10-17-20-15-8-3-4-9-16(15)21-17/h1-4,6-9,19H,5,10-12,18H2 |
| InChIKey | MTUUONSFWXHNOO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|