C14H12N2S — CID 62534023
2-(1,3-benzothiazol-2-ylmethyl)aniline (PubChem CID 62534023) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethyl)aniline.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 62534023 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethyl)aniline |
| SMILES | Nc1ccccc1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H12N2S/c15-11-6-2-1-5-10(11)9-14-16-12-7-3-4-8-13(12)17-14/h1-8H,9,15H2 |
| InChIKey | OOHDNOANJMPHMJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|