C11H10N6S — CID 155811809
6-(1,3-benzothiazol-2-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155811809) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,3-benzothiazol-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155811809 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(Cc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C11H10N6S/c12-10-15-8(16-11(13)17-10)5-9-14-6-3-1-2-4-7(6)18-9/h1-4H,5H2,(H4,12,13,15,16,17) |
| InChIKey | SWKMWWIXVJXWTP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |