C13H11N3S — CID 79818659
5-(1,3-benzothiazol-2-ylmethyl)pyridin-2-amine (PubChem CID 79818659) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylmethyl)pyridin-2-amine.
| Compound Name | 5-(1,3-benzothiazol-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 79818659 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylmethyl)pyridin-2-amine |
| SMILES | Nc1ccc(Cc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C13H11N3S/c14-12-6-5-9(8-15-12)7-13-16-10-3-1-2-4-11(10)17-13/h1-6,8H,7H2,(H2,14,15) |
| InChIKey | DBBKAYACNAEGSN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |