C12H8ClN3S — CID 105371357
2-[(4-chloropyrimidin-5-yl)methyl]-1,3-benzothiazole (PubChem CID 105371357) has the molecular formula C12H8ClN3S and a molecular weight of 261.74 g/mol. Its IUPAC name is 2-[(4-chloropyrimidin-5-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-chloropyrimidin-5-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 105371357 |
| Molecular Formula | C12H8ClN3S |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-[(4-chloropyrimidin-5-yl)methyl]-1,3-benzothiazole |
| SMILES | Clc1ncncc1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H8ClN3S/c13-12-8(6-14-7-15-12)5-11-16-9-3-1-2-4-10(9)17-11/h1-4,6-7H,5H2 |
| InChIKey | DOYALCLLFHHOBE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |