C12H9NS2 — CID 102192956
2-(thiophen-3-ylmethyl)-1,3-benzothiazole (PubChem CID 102192956) has the molecular formula C12H9NS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 2-(thiophen-3-ylmethyl)-1,3-benzothiazole.
| Compound Name | 2-(thiophen-3-ylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 102192956 |
| Molecular Formula | C12H9NS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-(thiophen-3-ylmethyl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(Cc3ccsc3)nc2c1 |
| InChI | InChI=1S/C12H9NS2/c1-2-4-11-10(3-1)13-12(15-11)7-9-5-6-14-8-9/h1-6,8H,7H2 |
| InChIKey | HYHRKMFBVVSHTE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |