C11H12INS — CID 148618103
2-(4-iodobutyl)-1,3-benzothiazole (PubChem CID 148618103) has the molecular formula C11H12INS and a molecular weight of 317.19 g/mol. Its IUPAC name is 2-(4-iodobutyl)-1,3-benzothiazole.
| Compound Name | 2-(4-iodobutyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 148618103 |
| Molecular Formula | C11H12INS |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-(4-iodobutyl)-1,3-benzothiazole |
| SMILES | ICCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H12INS/c12-8-4-3-7-11-13-9-5-1-2-6-10(9)14-11/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | NFRZWIRYMXGGRX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|