C14H21N3S — CID 145133826
5-(1,3-benzothiazol-2-yl)pentan-1-amine;ethenamine (PubChem CID 145133826) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)pentan-1-amine;ethenamine.
| Compound Name | 5-(1,3-benzothiazol-2-yl)pentan-1-amine;ethenamine |
|---|---|
| PubChem CID | 145133826 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)pentan-1-amine;ethenamine |
| SMILES | C=CN.NCCCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2S.C2H5N/c13-9-5-1-2-8-12-14-10-6-3-4-7-11(10)15-12;1-2-3/h3-4,6-7H,1-2,5,8-9,13H2;2H,1,3H2 |
| InChIKey | SYBWEFLNIQTUIJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|