C13H14N2S — CID 106220140
6-(1,3-benzothiazol-2-yl)hex-4-yn-1-amine (PubChem CID 106220140) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)hex-4-yn-1-amine.
| Compound Name | 6-(1,3-benzothiazol-2-yl)hex-4-yn-1-amine |
|---|---|
| PubChem CID | 106220140 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)hex-4-yn-1-amine |
| SMILES | NCCCC#CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H14N2S/c14-10-6-2-1-3-9-13-15-11-7-4-5-8-12(11)16-13/h4-5,7-8H,2,6,9-10,14H2 |
| InChIKey | LHCDBUYVQSKLHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|