C12H13NOS2 — CID 88700050
O-methyl 4-(1,3-benzothiazol-2-yl)butanethioate (PubChem CID 88700050) has the molecular formula C12H13NOS2 and a molecular weight of 251.38 g/mol. Its IUPAC name is O-methyl 4-(1,3-benzothiazol-2-yl)butanethioate.
| Compound Name | O-methyl 4-(1,3-benzothiazol-2-yl)butanethioate |
|---|---|
| PubChem CID | 88700050 |
| Molecular Formula | C12H13NOS2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | O-methyl 4-(1,3-benzothiazol-2-yl)butanethioate |
| SMILES | COC(=S)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NOS2/c1-14-12(15)8-4-7-11-13-9-5-2-3-6-10(9)16-11/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | CVLZBYIPGMOJHC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|