C14H10ClN3OS — CID 80725561
4-(1,3-benzothiazol-2-ylmethyl)-6-chloro-2-methylpyrimidine-5-carbaldehyde (PubChem CID 80725561) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethyl)-6-chloro-2-methylpyrimidine-5-carbaldehyde.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethyl)-6-chloro-2-methylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 80725561 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethyl)-6-chloro-2-methylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(Cc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C14H10ClN3OS/c1-8-16-11(9(7-19)14(15)17-8)6-13-18-10-4-2-3-5-12(10)20-13/h2-5,7H,6H2,1H3 |
| InChIKey | GUKNHCIJIDIJDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|