C13H9NO2S — CID 106886546
5-(1,3-benzothiazol-2-ylmethyl)furan-2-carbaldehyde (PubChem CID 106886546) has the molecular formula C13H9NO2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylmethyl)furan-2-carbaldehyde.
| Compound Name | 5-(1,3-benzothiazol-2-ylmethyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106886546 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylmethyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(Cc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C13H9NO2S/c15-8-10-6-5-9(16-10)7-13-14-11-3-1-2-4-12(11)17-13/h1-6,8H,7H2 |
| InChIKey | WSVQNOOHYSTGRJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|