C10H9NO2S — CID 79819003
3-(1,3-benzothiazol-2-yl)-2-hydroxypropanal (PubChem CID 79819003) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-hydroxypropanal.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-hydroxypropanal |
|---|---|
| PubChem CID | 79819003 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-hydroxypropanal |
| SMILES | O=CC(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9NO2S/c12-6-7(13)5-10-11-8-3-1-2-4-9(8)14-10/h1-4,6-7,13H,5H2 |
| InChIKey | JVRRXJORKFOEJX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|